CAS 114420-66-5 appears in our catalog under these names: Regaloside A, 95%, Regaloside A, Regaloside A/ 98.89% (existing batch purity), Regaloside A, Regaloside A 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 20mg, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S)-2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (CAS 114420-66-5) is a chemical compound with the molecular formula C18H24O10 and a molecular weight of 400.4 g/mol. IUPAC name: [(2S)-2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate. InChIKey: PADHSFRQMFRWLS-MUWVXHEGSA-N.
| Molecular formula | C18H24O10 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | [(2S)-2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChIKey | PADHSFRQMFRWLS-MUWVXHEGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)OC[C@H](COC2C(C(C(C(O2)CO)O)O)O)O)O |
Computed by PubChem (NCBI)