cas: 62058-03-1 — see every product listed under this CAS number, including other names
Rel-(1R,3S,4R)-4-aminoadamantan-1-ol 95% (CAS 62058-03-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A127634-10g |
| cas | 62058-03-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1076.81 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A127634 |
(3S)-4-aminoadamantan-1-ol (CAS 62058-03-1) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: (3S)-4-aminoadamantan-1-ol. InChIKey: HMPCLMSUNVOZLH-VDAKZHKGSA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | (3S)-4-aminoadamantan-1-ol |
| InChIKey | HMPCLMSUNVOZLH-VDAKZHKGSA-N |
| SMILES | C1[C@H]2CC3(CC1CC(C3)C2N)O |
Computed by PubChem (NCBI)