cas: 2660256-22-2 — see every product listed under this CAS number, including other names
Rel-1-(1,1-DiMethylEthyl) (2R,3S)-2-Methyl-1,3-azEtiDineDicarboxylate, 95% (CAS 2660256-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1312H7-100mg |
| cas | 2660256-22-2 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 500mg | 942.80 Pln | |
| Chemat | 1g | 1302.80 Pln | |
| Chemat | 5g | 4475.60 Pln | |
| Chemat | 10g | 7413.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 2660256-22-2) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: GLXXUWWAQCAPNM-NKWVEPMBSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | GLXXUWWAQCAPNM-NKWVEPMBSA-N |
| SMILES | C[C@H]1[C@@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)