CAS 2660256-22-2 appears in our catalog under these names: Rel-1-(1,1-DiMethylEthyl) (2R,3S)-2-Methyl-1,3-azEtiDineDicarboxylate, 97%, Rel-1-(1,1-DiMethylEthyl) (2R,3S)-2-Methyl-1,3-azEtiDineDicarboxylate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 500mg, 1g, 5g.
(2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 2660256-22-2) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: GLXXUWWAQCAPNM-NKWVEPMBSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | GLXXUWWAQCAPNM-NKWVEPMBSA-N |
| SMILES | C[C@H]1[C@@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)