cas: 178307-42-1 — see every product listed under this CAS number, including other names
Revaprazan HCl 98% (CAS 178307-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A838900-100mg |
| cas | 178307-42-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 2178.19 Pln | |
| Ambeed | 1g | 5588.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A838900 |
N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride (CAS 178307-42-1) is a chemical compound with the molecular formula C22H24ClFN4 and a molecular weight of 398.9 g/mol. IUPAC name: N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride. InChIKey: MALPZYQJEDBIAK-UHFFFAOYSA-N.
| Molecular formula | C22H24ClFN4 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride |
| InChIKey | MALPZYQJEDBIAK-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2CCN1C3=NC(=NC(=C3C)C)NC4=CC=C(C=C4)F.Cl |
Computed by PubChem (NCBI)