CAS 178307-42-1 appears in our catalog under these names: Revaprazan hydrochloride, 95%, Revaprazan HCl, Revaprazan Hydrochloride, Revaprazan hydrochloride/ 99.64% (existing batch purity), Revaprazan hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 1g, 100mg, 250mg, on request, 25mg, 50mg, 200mg, 500mg.
N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride (CAS 178307-42-1) is a chemical compound with the molecular formula C22H24ClFN4 and a molecular weight of 398.9 g/mol. IUPAC name: N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride. InChIKey: MALPZYQJEDBIAK-UHFFFAOYSA-N.
| Molecular formula | C22H24ClFN4 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride |
| InChIKey | MALPZYQJEDBIAK-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2CCN1C3=NC(=NC(=C3C)C)NC4=CC=C(C=C4)F.Cl |
Computed by PubChem (NCBI)