Rhodamine B Hydrazide 97%
cas: 74317-53-6 — see every product listed under this CAS number, including other names
Rhodamine B Hydrazide 97% (CAS 74317-53-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A615462-10g |
| cas | 74317-53-6 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6939.69 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 3919.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A615462 |
2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (CAS 74317-53-6) is a chemical compound with the molecular formula C28H32N4O2 and a molecular weight of 456.6 g/mol. IUPAC name: 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one. InChIKey: WTDHTIVYKKLOTC-UHFFFAOYSA-N.
| Molecular formula | C28H32N4O2 |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N |
Computed by PubChem (NCBI)
Synonyms:
Rhodamine B hydrazide, 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one, 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one, s10743, 2-amino-3',6'-bis(diethylamino)-2,3-dihydrospiro[isoindole-1,9'-xanthen]-3-one, Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-amino-3',6'-bis(diethylamino)-, Rhodamine B CU2+ sen, Rhodamine B Cu2+ sensor, orb1943488, 2-amino-12,15-bis(diethylamino)spiro[isoindoline-3,9'-xanthene]-1-one