Products 74317-53-6

CAS 74317-53-6 appears in our catalog under these names: Rhodamine B hydrazide, Rhodamine B hydrazide, Rhodamine B Hydrazide, >98.0%(HPLC)(T), Rhodamine B Hydrazide 97%, Rhodamine B hydrazide, 99.87%. Offered by: GLPBio, TargetMol, TCI, Biosynth, Ambeed. Available pack sizes: 100mg, 50mg, 5mg, 10mg, 25mg, 200mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (CAS 74317-53-6) is a chemical compound with the molecular formula C28H32N4O2 and a molecular weight of 456.6 g/mol. IUPAC name: 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one. InChIKey: WTDHTIVYKKLOTC-UHFFFAOYSA-N.

Identity
Molecular formulaC28H32N4O2
Molecular weight456.6 g/mol
IUPAC name2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one
InChIKeyWTDHTIVYKKLOTC-UHFFFAOYSA-N
SMILESCCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N

Computed by PubChem (NCBI)