CAS 74317-53-6 appears in our catalog under these names: Rhodamine B hydrazide, Rhodamine B hydrazide, Rhodamine B Hydrazide, >98.0%(HPLC)(T), Rhodamine B Hydrazide 97%, Rhodamine B hydrazide, 99.87%. Offered by: GLPBio, TargetMol, TCI, Biosynth, Ambeed. Available pack sizes: 100mg, 50mg, 5mg, 10mg, 25mg, 200mg, 1g, 250mg.
2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (CAS 74317-53-6) is a chemical compound with the molecular formula C28H32N4O2 and a molecular weight of 456.6 g/mol. IUPAC name: 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one. InChIKey: WTDHTIVYKKLOTC-UHFFFAOYSA-N.
| Molecular formula | C28H32N4O2 |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N |
Computed by PubChem (NCBI)