Rhododendrol
cas: 501-96-2 — see every product listed under this CAS number, including other names
Rhododendrol (CAS 501-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T19924-1mg |
| cas | 501-96-2 |
| size | 1mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 558.88 Pln | |
| TargetMol | 5mg | 944.03 Pln | |
| TargetMol | 10mg | 1322.47 Pln | |
| TargetMol | 25mg | 2192.28 Pln | |
| TargetMol | 50mg | 3082.20 Pln | |
| TargetMol | 100mg | 4244.37 Pln | |
| TargetMol | 200mg | 5639.07 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
4-[(3R)-3-hydroxybutyl]phenol (CAS 501-96-2) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 4-[(3R)-3-hydroxybutyl]phenol. InChIKey: SFUCGABQOMYVJW-MRVPVSSYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 4-[(3R)-3-hydroxybutyl]phenol |
| InChIKey | SFUCGABQOMYVJW-MRVPVSSYSA-N |
| SMILES | C[C@H](CCC1=CC=C(C=C1)O)O |
Computed by PubChem (NCBI)