CAS 501-96-2 appears in our catalog under these names: Rhododendrol, 95%, (-)-Rhododendrol, Rhododendrol, (R)-4-(3-Hydroxybutyl)phenol, 98%, 98%. Offered by: Combi-blocks, TRC, TargetMol, Chemat. Available pack sizes: 250mg, 1g, 25mg, 1mg, 5mg, 10mg, 50mg, 100mg.
4-[(3R)-3-hydroxybutyl]phenol (CAS 501-96-2) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 4-[(3R)-3-hydroxybutyl]phenol. InChIKey: SFUCGABQOMYVJW-MRVPVSSYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 4-[(3R)-3-hydroxybutyl]phenol |
| InChIKey | SFUCGABQOMYVJW-MRVPVSSYSA-N |
| SMILES | C[C@H](CCC1=CC=C(C=C1)O)O |
Computed by PubChem (NCBI)