Products 1281870-42-5
CAS 1281870-42-5 appears in our catalog under these names: Rhosin hydrochloride, Rhosin Hydrochloride, Rhosin hydrochloride/ 98.92% (existing batch purity), Rhosin hydrochloride, 99%, 99%, Rhosin (hydrochloride), 99.94%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 500mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg.
(2R)-2-amino-3-(1H-indol-3-yl)-N-[(E)-quinoxalin-6-ylmethylideneamino]propanamide;hydrochloride (CAS 1281870-42-5) is a chemical compound with the molecular formula C20H19ClN6O and a molecular weight of 394.9 g/mol. IUPAC name: (2R)-2-amino-3-(1H-indol-3-yl)-N-[(E)-quinoxalin-6-ylmethylideneamino]propanamide;hydrochloride. InChIKey: SFRGBDFQSLZYLF-GRYLRVQNSA-N.
| Molecular formula | C20H19ClN6O |
|---|---|
| Molecular weight | 394.9 g/mol |
| IUPAC name | (2R)-2-amino-3-(1H-indol-3-yl)-N-[(E)-quinoxalin-6-ylmethylideneamino]propanamide;hydrochloride |
| InChIKey | SFRGBDFQSLZYLF-GRYLRVQNSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)N/N=C/C3=CC4=NC=CN=C4C=C3)N.Cl |
Computed by PubChem (NCBI)