CAS 850608-87-6 appears in our catalog under these names: Riluzole Hydrochloride, Riluzole hydrochloride/ 99.76% (existing batch purity), Riluzole (hydrochloride), 6-(Trifluoromethoxy)benzo[d]thiazol-2-amine hydrochloride, 99%, 99%, Riluzole hydrochloride, 99.94%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 25mg, 50mg, 10mg, 250mg, 100 mg, 10mM/1mL, 500 mg.
6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride (CAS 850608-87-6) is a chemical compound with the molecular formula C8H6ClF3N2OS and a molecular weight of 270.66 g/mol. IUPAC name: 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: QEAOELIJQRYJJS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2OS |
|---|---|
| Molecular weight | 270.66 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | QEAOELIJQRYJJS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)SC(=N2)N.Cl |
Computed by PubChem (NCBI)