cas: 808732-98-1 — see every product listed under this CAS number, including other names
Rislenemdaz 98% (CAS 808732-98-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A709210-1mg |
| cas | 808732-98-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 320.31 Pln | |
| Ambeed | 5mg | 448.25 Pln | |
| Ambeed | 10mg | 637.38 Pln | |
| Ambeed | 25mg | 921.06 Pln | |
| Ambeed | 50mg | 1432.81 Pln | |
| Ambeed | 100mg | 2250.50 Pln | |
| Ambeed | 250mg | 4202.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A709210 |
(4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate (CAS 808732-98-1) is a chemical compound with the molecular formula C19H23FN4O2 and a molecular weight of 358.4 g/mol. IUPAC name: (4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate. InChIKey: RECBFDWSXWAXHY-IAGOWNOFSA-N.
| Molecular formula | C19H23FN4O2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate |
| InChIKey | RECBFDWSXWAXHY-IAGOWNOFSA-N |
| SMILES | CC1=CC=C(C=C1)COC(=O)N2CC[C@@H]([C@@H](C2)F)CNC3=NC=CC=N3 |
Computed by PubChem (NCBI)