CAS 808732-98-1 appears in our catalog under these names: Rislenemdaz, 98%, Rislenemdaz (MK–0657), 4-Methylbenzyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate, 98%, 98%, Mk-0657, 95%, Rislenemdaz/ 98.18% (existing batch purity). Offered by: Ambeed, GLPBio, Chemat, Combi-blocks, TargetMol. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate (CAS 808732-98-1) is a chemical compound with the molecular formula C19H23FN4O2 and a molecular weight of 358.4 g/mol. IUPAC name: (4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate. InChIKey: RECBFDWSXWAXHY-IAGOWNOFSA-N.
| Molecular formula | C19H23FN4O2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (4-methylphenyl)methyl (3S,4R)-3-fluoro-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate |
| InChIKey | RECBFDWSXWAXHY-IAGOWNOFSA-N |
| SMILES | CC1=CC=C(C=C1)COC(=O)N2CC[C@@H]([C@@H](C2)F)CNC3=NC=CC=N3 |
Computed by PubChem (NCBI)