CAS 872573-93-8 appears in our catalog under these names: Ro-3306/ 98.66% (existing batch purity), Ro 3306, RO-3306, 98.00%, RO-3306 98%, Cdk1 Inhibitor IV, RO-3306 1PC X 5MG. Offered by: TargetMol, GLPBio, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(5Z)-5-(quinolin-6-ylmethylidene)-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one (CAS 872573-93-8) is a chemical compound with the molecular formula C18H13N3OS2 and a molecular weight of 351.4 g/mol. IUPAC name: (5Z)-5-(quinolin-6-ylmethylidene)-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one. InChIKey: XOLMRFUGOINFDQ-YBEGLDIGSA-N.
| Molecular formula | C18H13N3OS2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (5Z)-5-(quinolin-6-ylmethylidene)-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one |
| InChIKey | XOLMRFUGOINFDQ-YBEGLDIGSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)/C=C\3/C(=O)NC(=NCC4=CC=CS4)S3)N=C1 |
Computed by PubChem (NCBI)