Rosiglitazone maleate, 99%
cas: 155141-29-0 — see every product listed under this CAS number, including other names
Rosiglitazone maleate, 99% (CAS 155141-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 1mg, 10mg, 50mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A332359-250mg |
| cas | 155141-29-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 715.25 Pln | |
| Ambeed | 10g | 1321.56 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 10mg | 93.20 Pln | |
| Chemat | 50mg | 122.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 414.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(Z)-but-2-enedioic acid;5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 155141-29-0) is a chemical compound with the molecular formula C22H23N3O7S and a molecular weight of 473.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: SUFUKZSWUHZXAV-BTJKTKAUSA-N.
| Molecular formula | C22H23N3O7S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | SUFUKZSWUHZXAV-BTJKTKAUSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)