CAS 956239-35-3 appears in our catalog under these names: Rosiglitazone Impurity 3, Rosiglitazone N-(2-Succinic Acid), N-(1,2-DICARBOXYETHYL) ROSIGLITAZONE. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 25mg, 10mg, 50mg.
2-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanedioic acid (CAS 956239-35-3) is a chemical compound with the molecular formula C22H23N3O7S and a molecular weight of 473.5 g/mol. IUPAC name: 2-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanedioic acid. InChIKey: XZEIFCBFLCYRAH-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O7S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 2-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanedioic acid |
| InChIKey | XZEIFCBFLCYRAH-UHFFFAOYSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)N(C(=O)S2)C(CC(=O)O)C(=O)O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)