CAS 29574-21-8 appears in our catalog under these names: Roslin 2 bromide/ 97.07% (existing batch purity), Roslin–2, Roslin-2, Roslin 2 (bromide), 99.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane bromide (CAS 29574-21-8) is a chemical compound with the molecular formula C13H19BrN4 and a molecular weight of 311.22 g/mol. IUPAC name: 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane bromide. InChIKey: YJMKPGPWDHCYCD-UHFFFAOYSA-M.
| Molecular formula | C13H19BrN4 |
|---|---|
| Molecular weight | 311.22 g/mol |
| IUPAC name | 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane bromide |
| InChIKey | YJMKPGPWDHCYCD-UHFFFAOYSA-M |
| SMILES | C1N2CN3CN1C[N+](C2)(C3)CC4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)