RuPhos Pd G2, 98%
cas: 1375325-68-0 — see every product listed under this CAS number, including other names
RuPhos Pd G2, 98% (CAS 1375325-68-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F983738-250MG |
| cas | 1375325-68-0 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 601.89 Pln | |
| Fluorochem | 10g | 1122.54 Pln | |
| Fluorochem | 25g | 2356.48 Pln | |
| Fluorochem | 100g | 8984.35 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 681.88 Pln | |
| Ambeed | 10g | 1238.12 Pln | |
| Ambeed | 25g | 2834.56 Pln | |
| Ambeed | 100g | 11111.56 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline (CAS 1375325-68-0) is a chemical compound with the molecular formula C42H53ClNO2PPd and a molecular weight of 776.7 g/mol. IUPAC name: chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline. InChIKey: NVVXJVMOIGXUGC-UHFFFAOYSA-M.
| Molecular formula | C42H53ClNO2PPd |
|---|---|
| Molecular weight | 776.7 g/mol |
| IUPAC name | chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline |
| InChIKey | NVVXJVMOIGXUGC-UHFFFAOYSA-M |
| SMILES | CC(C)OC1=C(C(=CC=C1)OC(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.C1=CC=C([C-]=C1)C2=CC=CC=C2N.Cl[Pd+] |
Computed by PubChem (NCBI)
Synonyms:
[RuPhos Palladacycle], NVVXJVMOIGXUGC-UHFFFAOYSA-M