CAS 1375325-68-0 appears in our catalog under these names: Chloro(2-dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl)[2-(2'-amino-1,1'-biphenyl)]palladium(II), 95%, RuPhos Pd G2, RuPhos Pd G2 98%, RUPHOS PD G2, RUPHOS PD G2 CHEMBEADS. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100g, 100mg, 50g.
Chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline (CAS 1375325-68-0) is a chemical compound with the molecular formula C42H53ClNO2PPd and a molecular weight of 776.7 g/mol. IUPAC name: chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline. InChIKey: NVVXJVMOIGXUGC-UHFFFAOYSA-M.
| Molecular formula | C42H53ClNO2PPd |
|---|---|
| Molecular weight | 776.7 g/mol |
| IUPAC name | chloropalladium(1+);dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane;2-phenylaniline |
| InChIKey | NVVXJVMOIGXUGC-UHFFFAOYSA-M |
| SMILES | CC(C)OC1=C(C(=CC=C1)OC(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.C1=CC=C([C-]=C1)C2=CC=CC=C2N.Cl[Pd+] |
Computed by PubChem (NCBI)