cas: 918870-76-5 — see every product listed under this CAS number, including other names
Ruthenium, [1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[[5-[(dimethylamino)sulfonyl]-2-(1-methylethoxy-κO)phenyl]methylene-κC]-, (SP-5-41)-, 95%, 95% (CAS 918870-76-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AJ9-50mg |
| cas | 918870-76-5 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 150.80 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3851.60 Pln | |
| Chemat | 10g | 5738.00 Pln | |
| Chemat | 25g | 13250.00 Pln | |
| Chemat | 50g | 24419.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium (CAS 918870-76-5) is a chemical compound with the molecular formula C33H43Cl2N3O3RuS and a molecular weight of 733.8 g/mol. IUPAC name: [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium. InChIKey: OXLURKCRXVAJQS-UHFFFAOYSA-L.
| Molecular formula | C33H43Cl2N3O3RuS |
|---|---|
| Molecular weight | 733.8 g/mol |
| IUPAC name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| InChIKey | OXLURKCRXVAJQS-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C(=C1)C)N2CCN(C2=[Ru](=CC3=C(C=CC(=C3)S(=O)(=O)N(C)C)OC(C)C)(Cl)Cl)C4=C(C=C(C=C4C)C)C)C |
Computed by PubChem (NCBI)