Zhan Catalyst-1B, 95%
cas: 918870-76-5 — see every product listed under this CAS number, including other names
Zhan Catalyst-1B, 95% (CAS 918870-76-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987736-100MG |
| cas | 918870-76-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 4704.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium (CAS 918870-76-5) is a chemical compound with the molecular formula C33H43Cl2N3O3RuS and a molecular weight of 733.8 g/mol. IUPAC name: [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium. InChIKey: OXLURKCRXVAJQS-UHFFFAOYSA-L.
| Molecular formula | C33H43Cl2N3O3RuS |
|---|---|
| Molecular weight | 733.8 g/mol |
| IUPAC name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| InChIKey | OXLURKCRXVAJQS-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C(=C1)C)N2CCN(C2=[Ru](=CC3=C(C=CC(=C3)S(=O)(=O)N(C)C)OC(C)C)(Cl)Cl)C4=C(C=C(C=C4C)C)C)C |
Computed by PubChem (NCBI)