CAS 158089-95-3 appears in our catalog under these names: S-2474/ 98.72% (existing batch purity), S–2474, S 2474, Phenol, 2,6-bis(1,1-dimethylethyl)-4-[(E)-(2-ethyl-1,1-dioxido-5-isothiazolidinylidene)methyl]-, S-2474. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 20mg, 5 mg, 10 mg.
2,6-ditert-butyl-4-[(2-ethyl-1,1-dioxo-1,2-thiazolidin-5-ylidene)methyl]phenol (CAS 158089-95-3) is a chemical compound with the molecular formula C20H31NO3S and a molecular weight of 365.5 g/mol. IUPAC name: 2,6-ditert-butyl-4-[(2-ethyl-1,1-dioxo-1,2-thiazolidin-5-ylidene)methyl]phenol. InChIKey: HFWZBWTWCKQUCB-UHFFFAOYSA-N.
| Molecular formula | C20H31NO3S |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[(2-ethyl-1,1-dioxo-1,2-thiazolidin-5-ylidene)methyl]phenol |
| InChIKey | HFWZBWTWCKQUCB-UHFFFAOYSA-N |
| SMILES | CCN1CCC(=CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)S1(=O)=O |
Computed by PubChem (NCBI)