CAS 1124381-69-6 appears in our catalog under these names: S-99/ 99.84% (existing batch purity), S–99, S-99, ASK1-IN-5. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
N-[5-(propan-2-ylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide (CAS 1124381-69-6) is a chemical compound with the molecular formula C16H15F3N6O and a molecular weight of 364.32 g/mol. IUPAC name: N-[5-(propan-2-ylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide. InChIKey: BDAJJFZKNIYDOL-UHFFFAOYSA-N.
| Molecular formula | C16H15F3N6O |
|---|---|
| Molecular weight | 364.32 g/mol |
| IUPAC name | N-[5-(propan-2-ylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide |
| InChIKey | BDAJJFZKNIYDOL-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=CC2=NC(=NN12)NC(=O)C3=CN=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)