cas: 1352221-63-6 — see every product listed under this CAS number, including other names
S-Acetyl-peg6-alcohol, 98%, 98% (CAS 1352221-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HTYF-100mg |
| cas | 1352221-63-6 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 1g | 2354.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate (CAS 1352221-63-6) is a chemical compound with the molecular formula C14H28O7S and a molecular weight of 340.44 g/mol. IUPAC name: S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate. InChIKey: MKRGYWYYHKOEAV-UHFFFAOYSA-N.
| Molecular formula | C14H28O7S |
|---|---|
| Molecular weight | 340.44 g/mol |
| IUPAC name | S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
| InChIKey | MKRGYWYYHKOEAV-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)