CAS 1352221-63-6 appears in our catalog under these names: S-Acetyl-peg6-alcohol, 95%, S–acetyl–PEG6, S-Acetyl-PEG6-alcohol, S-Acetyl-peg6-alcohol, 98%, 98%, S-acetyl-PEG6. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 500mg, 100mg, 100 mg, 25 mg, 5 mg.
S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate (CAS 1352221-63-6) is a chemical compound with the molecular formula C14H28O7S and a molecular weight of 340.44 g/mol. IUPAC name: S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate. InChIKey: MKRGYWYYHKOEAV-UHFFFAOYSA-N.
| Molecular formula | C14H28O7S |
|---|---|
| Molecular weight | 340.44 g/mol |
| IUPAC name | S-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
| InChIKey | MKRGYWYYHKOEAV-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)