CAS 1184843-57-9 appears in our catalog under these names: SAR–020106, SAR-020106/ 97.78% (existing batch purity), SAR-020106, SAR-020106 98%, SAR-020106, ≥97%, ≥97%. Offered by: GLPBio, TargetMol, Chemat, Biosynth, Ambeed. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 100mg, 5 mg.
5-[(8-chloroisoquinolin-3-yl)amino]-3-[(2R)-1-(dimethylamino)propan-2-yl]oxypyrazine-2-carbonitrile (CAS 1184843-57-9) is a chemical compound with the molecular formula C19H19ClN6O and a molecular weight of 382.8 g/mol. IUPAC name: 5-[(8-chloroisoquinolin-3-yl)amino]-3-[(2R)-1-(dimethylamino)propan-2-yl]oxypyrazine-2-carbonitrile. InChIKey: SRBJWIBAMIKCMV-GFCCVEGCSA-N.
| Molecular formula | C19H19ClN6O |
|---|---|
| Molecular weight | 382.8 g/mol |
| IUPAC name | 5-[(8-chloroisoquinolin-3-yl)amino]-3-[(2R)-1-(dimethylamino)propan-2-yl]oxypyrazine-2-carbonitrile |
| InChIKey | SRBJWIBAMIKCMV-GFCCVEGCSA-N |
| SMILES | C[C@H](CN(C)C)OC1=NC(=CN=C1C#N)NC2=NC=C3C(=C2)C=CC=C3Cl |
Computed by PubChem (NCBI)