CAS 1450881-55-6 appears in our catalog under these names: SAR-20347, SAR-20347/ 99.54% (existing batch purity), SAR–20347, SAR-20347, 98%, 98%, SAR-20347, 97.27%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 250mg.
2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide (CAS 1450881-55-6) is a chemical compound with the molecular formula C21H18ClFN4O4 and a molecular weight of 444.8 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide. InChIKey: HEDPDFHTQKEORT-UHFFFAOYSA-N.
| Molecular formula | C21H18ClFN4O4 |
|---|---|
| Molecular weight | 444.8 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide |
| InChIKey | HEDPDFHTQKEORT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC=C(C=C2)NC3=C(N=C(O3)C4=C(C=CC=C4Cl)F)C(=O)N |
Computed by PubChem (NCBI)