cas: 352659-40-6 — see every product listed under this CAS number, including other names
SARS-CoV-2 3CLpro-IN-16 (CAS 352659-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch13DI7X-1mg |
| cas | 352659-40-6 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 947.60 Pln | |
| Chemat | 5mg | 2291.60 Pln | |
| Chemat | 10mg | 3328.40 Pln | |
| Chemat | 25mg | 5210.00 Pln | |
| Chemat | 50mg | 6856.40 Pln | |
| Chemat | 100mg | 9424.40 Pln | |
| Chemat | 500mg | 18866.00 Pln | |
| MedChemExpress | 5 mg | 4411.06 Pln | |
| MedChemExpress | 10 mg | 6384.76 Pln | |
| MedChemExpress | 1 mg | 1838.28 Pln |
| delivery time | 3 weeks |
|---|
[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate (CAS 352659-40-6) is a chemical compound with the molecular formula C17H14N2OS and a molecular weight of 294.4 g/mol. IUPAC name: [2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate. InChIKey: BWJPRMXKIWYPAB-UHFFFAOYSA-N.
| Molecular formula | C17H14N2OS |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | [2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate |
| InChIKey | BWJPRMXKIWYPAB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C3=CC=CC=C31)C(=O)CSC#N |
Computed by PubChem (NCBI)