CAS 314768-41-7 is the registry number for R523062. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-benzyl-N-pyridin-2-ylthiophene-2-carboxamide (CAS 314768-41-7) is a chemical compound with the molecular formula C17H14N2OS and a molecular weight of 294.4 g/mol. IUPAC name: N-benzyl-N-pyridin-2-ylthiophene-2-carboxamide. InChIKey: AVNHLGOIGSJODA-UHFFFAOYSA-N.
| Molecular formula | C17H14N2OS |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-benzyl-N-pyridin-2-ylthiophene-2-carboxamide |
| InChIKey | AVNHLGOIGSJODA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=N2)C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)