CAS 2768834-39-3 appears in our catalog under these names: SARS-CoV-2 Mpro-IN-2/ 99.97% (existing batch purity), SARS–CoV–2 Mpro–IN–2, SARS-CoV-2 Mpro-IN-2, SARS-CoV-2 Mpro-IN-2, 98.96%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 50 mg, 25 mg.
(2S)-1-(3,4-dichlorophenyl)-4-(pyridine-3-carbonyl)-N-(thiophen-2-ylmethyl)piperazine-2-carboxamide (CAS 2768834-39-3) is a chemical compound with the molecular formula C22H20Cl2N4O2S and a molecular weight of 475.4 g/mol. IUPAC name: (2S)-1-(3,4-dichlorophenyl)-4-(pyridine-3-carbonyl)-N-(thiophen-2-ylmethyl)piperazine-2-carboxamide. InChIKey: XEFYJHCPILXFKJ-FQEVSTJZSA-N.
| Molecular formula | C22H20Cl2N4O2S |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | (2S)-1-(3,4-dichlorophenyl)-4-(pyridine-3-carbonyl)-N-(thiophen-2-ylmethyl)piperazine-2-carboxamide |
| InChIKey | XEFYJHCPILXFKJ-FQEVSTJZSA-N |
| SMILES | C1CN([C@@H](CN1C(=O)C2=CN=CC=C2)C(=O)NCC3=CC=CS3)C4=CC(=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)