CAS 554403-49-5 appears in our catalog under these names: WAY–181187, SAX-187/ 97.82% (existing batch purity), WAY 181187, WAY-181187 98+%, 2-(1-((6-Chloroimidazo[2,1-b]thiazol-5-yl)sulfonyl)-1H-indol-3-yl)ethan-1-amine, 98+%, 98+%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylindol-3-yl]ethanamine (CAS 554403-49-5) is a chemical compound with the molecular formula C15H13ClN4O2S2 and a molecular weight of 380.9 g/mol. IUPAC name: 2-[1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylindol-3-yl]ethanamine. InChIKey: RYBOXBBYCVOYNO-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4O2S2 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 2-[1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylindol-3-yl]ethanamine |
| InChIKey | RYBOXBBYCVOYNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2S(=O)(=O)C3=C(N=C4N3C=CS4)Cl)CCN |
Computed by PubChem (NCBI)