CAS 301836-41-9 appears in our catalog under these names: SB 431542, >95% (HPLC), sb431542, SB-431542/ 99.87% (existing batch purity), SB 431542, SB 431542, >97.0%(HPLC). Offered by: TRC, TargetMol, GLPBio, TCI, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 500mg, 5mg, 100mg, 10mM (in 1ml dmso), 1mg.
4-[4-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1H-imidazol-2-yl]benzamide (CAS 301836-41-9) is a chemical compound with the molecular formula C22H16N4O3 and a molecular weight of 384.4 g/mol. IUPAC name: 4-[4-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1H-imidazol-2-yl]benzamide. InChIKey: FHYUGAJXYORMHI-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O3 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 4-[4-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1H-imidazol-2-yl]benzamide |
| InChIKey | FHYUGAJXYORMHI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(NC(=N3)C4=CC=C(C=C4)C(=O)N)C5=CC=CC=N5 |
Computed by PubChem (NCBI)