CAS 314757-85-2 is the registry number for 2-(2-(5-Oxo-1,3-diphenyl-1,5-dihydro-4H-pyrazol-4-ylidene)hydrazinyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoic acid (CAS 314757-85-2) is a chemical compound with the molecular formula C22H16N4O3 and a molecular weight of 384.4 g/mol. IUPAC name: 2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoic acid. InChIKey: CCFRZZSFKIHNBR-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O3 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoic acid |
| InChIKey | CCFRZZSFKIHNBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)N(N2)C3=CC=CC=C3)N=NC4=CC=CC=C4C(=O)O |
Computed by PubChem (NCBI)