CAS 459429-39-1 appears in our catalog under these names: SB 452533, SB 452533, SB 452533/ 98.52% (existing batch purity), 1-(2-Bromophenyl)-3-(2-(ethyl(m-tolyl)amino)ethyl)urea, 98%, 98%, SB 452533, 99.11%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 500mg, 10mg, 25mg, 5mg, 50mg, 2mg, 100mg.
1-(2-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea (CAS 459429-39-1) is a chemical compound with the molecular formula C18H22BrN3O and a molecular weight of 376.3 g/mol. IUPAC name: 1-(2-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea. InChIKey: IFJYEGJUQIBBQV-UHFFFAOYSA-N.
| Molecular formula | C18H22BrN3O |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | 1-(2-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
| InChIKey | IFJYEGJUQIBBQV-UHFFFAOYSA-N |
| SMILES | CCN(CCNC(=O)NC1=CC=CC=C1Br)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)