Products 179258-62-9
CAS 179258-62-9 appears in our catalog under these names: SB-237376 HCl/ 99.49% (existing batch purity), SB-237376. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide;hydrochloride (CAS 179258-62-9) is a chemical compound with the molecular formula C20H26ClN3O5 and a molecular weight of 423.9 g/mol. IUPAC name: N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide;hydrochloride. InChIKey: QLUVAVFNMRXIIZ-UHFFFAOYSA-N.
| Molecular formula | C20H26ClN3O5 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide;hydrochloride |
| InChIKey | QLUVAVFNMRXIIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCNCCCNC(=O)C2=CC=C(C=C2)[N+](=O)[O-])OC.Cl |
Computed by PubChem (NCBI)