CAS 447410-57-3 appears in our catalog under these names: SB756050/ 98.78% (existing batch purity), SB756050, SB-756050, SB-756050, 98%, 98%, SB756050, 98.89%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg, 10mM/1mL.
1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-1,4-diazepane (CAS 447410-57-3) is a chemical compound with the molecular formula C21H28N2O8S2 and a molecular weight of 500.6 g/mol. IUPAC name: 1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-1,4-diazepane. InChIKey: GJUFPAZNBPFNRI-UHFFFAOYSA-N.
| Molecular formula | C21H28N2O8S2 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-1,4-diazepane |
| InChIKey | GJUFPAZNBPFNRI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCCN(CC2)S(=O)(=O)C3=CC(=C(C=C3)OC)OC)OC |
Computed by PubChem (NCBI)