Products 1849603-72-0
CAS 1849603-72-0 appears in our catalog under these names: SBI-553/ 99.69% (existing batch purity), SBI–553, SBI-553, SBI-553 98% HPLC, SBI-553, 98% HPLC, 98% HPLC. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso), 250mg.
2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]ethanol (CAS 1849603-72-0) is a chemical compound with the molecular formula C26H31FN4O2 and a molecular weight of 450.5 g/mol. IUPAC name: 2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]ethanol. InChIKey: BLWXTJQMEBQCIZ-UHFFFAOYSA-N.
| Molecular formula | C26H31FN4O2 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]ethanol |
| InChIKey | BLWXTJQMEBQCIZ-UHFFFAOYSA-N |
| SMILES | CN(CCO)C1=CC2=C(C=C1)N=C(N=C2N3CCC(CC3)C4=CC=CC=C4OC)C5(CC5)F |
Computed by PubChem (NCBI)