CAS 1282606-48-7 appears in our catalog under these names: SCD1 inhibitor-3/ 98.95% (existing batch purity), SCD1 inhibitor–3, SCD1 inhibitor-3, SCD1 inhibitor-3, 98.24%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
3-[1-[(4-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-5-carboxamide (CAS 1282606-48-7) is a chemical compound with the molecular formula C19H16FN7O2 and a molecular weight of 393.4 g/mol. IUPAC name: 3-[1-[(4-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-5-carboxamide. InChIKey: FAIXKYSRYKWWGK-UHFFFAOYSA-N.
| Molecular formula | C19H16FN7O2 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 3-[1-[(4-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-5-carboxamide |
| InChIKey | FAIXKYSRYKWWGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=O)C2=CC(=NN2)N3C=NN(C3=O)CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)