cas: 891494-63-6 — see every product listed under this CAS number, including other names
SCH900776 99% (CAS 891494-63-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A200833-1mg |
| cas | 891494-63-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 437.12 Pln | |
| Ambeed | 2mg | 620.69 Pln | |
| Ambeed | 5mg | 1004.50 Pln | |
| Ambeed | 10mg | 1716.50 Pln | |
| Ambeed | 25mg | 2912.44 Pln | |
| Ambeed | 50mg | 4119.50 Pln | |
| Ambeed | 100mg | 5738.19 Pln | |
| Ambeed | 250mg | 9593.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A200833 |
6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine (CAS 891494-63-6) is a chemical compound with the molecular formula C15H18BrN7 and a molecular weight of 376.25 g/mol. IUPAC name: 6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: GMIZZEXBPRLVIV-SECBINFHSA-N.
| Molecular formula | C15H18BrN7 |
|---|---|
| Molecular weight | 376.25 g/mol |
| IUPAC name | 6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | GMIZZEXBPRLVIV-SECBINFHSA-N |
| SMILES | CN1C=C(C=N1)C2=C3N=C(C(=C(N3N=C2)N)Br)[C@@H]4CCCNC4 |
Computed by PubChem (NCBI)