CAS 891494-63-6 appears in our catalog under these names: SCH900776/ 98.35% (existing batch purity), MK–8776(SCH–900776), MK-8776 (SCH 900776), SCH900776, SCH900776 99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine (CAS 891494-63-6) is a chemical compound with the molecular formula C15H18BrN7 and a molecular weight of 376.25 g/mol. IUPAC name: 6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: GMIZZEXBPRLVIV-SECBINFHSA-N.
| Molecular formula | C15H18BrN7 |
|---|---|
| Molecular weight | 376.25 g/mol |
| IUPAC name | 6-bromo-3-(1-methylpyrazol-4-yl)-5-[(3R)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | GMIZZEXBPRLVIV-SECBINFHSA-N |
| SMILES | CN1C=C(C=N1)C2=C3N=C(C(=C(N3N=C2)N)Br)[C@@H]4CCCNC4 |
Computed by PubChem (NCBI)