CAS 2764615-55-4 appears in our catalog under these names: SCP1-IN-1/ 97.24% (existing batch purity), SCP1–IN–1, SCP1-IN-1, SCP1-IN-1, 98.42%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
1,1-dioxo-N-[2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethoxy]ethyl]-1-benzothiophene-2-carboxamide (CAS 2764615-55-4) is a chemical compound with the molecular formula C20H19F3N2O7S2 and a molecular weight of 520.5 g/mol. IUPAC name: 1,1-dioxo-N-[2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethoxy]ethyl]-1-benzothiophene-2-carboxamide. InChIKey: LOPHIWMZIIGDGK-UHFFFAOYSA-N.
| Molecular formula | C20H19F3N2O7S2 |
|---|---|
| Molecular weight | 520.5 g/mol |
| IUPAC name | 1,1-dioxo-N-[2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethoxy]ethyl]-1-benzothiophene-2-carboxamide |
| InChIKey | LOPHIWMZIIGDGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2(=O)=O)C(=O)NCCOCCNS(=O)(=O)C3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)