cas: 1533426-72-0 — see every product listed under this CAS number, including other names
SCR7 (CAS 1533426-72-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso). Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T3340-1mg |
| cas | 1533426-72-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 691.36 Pln | |
| TargetMol | 5mg | 1920.04 Pln | |
| TargetMol | 10mg | 3102.33 Pln | |
| TargetMol | 25mg | 5612.24 Pln | |
| GLPBio | 25mg | 1327.20 Pln | |
| GLPBio | 5mg | 718.73 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 742.14 Pln | |
| Chemat | 5mg | 520.40 Pln | |
| Chemat | 10mg | 957.20 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one (CAS 1533426-72-0) is a chemical compound with the molecular formula C18H14N4OS and a molecular weight of 334.4 g/mol. IUPAC name: 5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: NEEVCWPRIZJJRJ-LWRDCAMISA-N.
| Molecular formula | C18H14N4OS |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | NEEVCWPRIZJJRJ-LWRDCAMISA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=C(NC(=S)NC2=O)/N=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)