CAS 1533426-72-0 appears in our catalog under these names: Scr7, 95%, SCR7, SCR7, 98.22%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso).
5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one (CAS 1533426-72-0) is a chemical compound with the molecular formula C18H14N4OS and a molecular weight of 334.4 g/mol. IUPAC name: 5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: NEEVCWPRIZJJRJ-LWRDCAMISA-N.
| Molecular formula | C18H14N4OS |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 5-(benzylideneamino)-6-[(E)-benzylideneamino]-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | NEEVCWPRIZJJRJ-LWRDCAMISA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=C(NC(=S)NC2=O)/N=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)