CAS 115621-95-9 appears in our catalog under these names: SDZ-62-434/ 98.61% (existing batch purity), SDZ 62-434, SDZ-62-434. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 1 mg, 10 mg.
5-(4-piperidin-1-ylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline;dihydrochloride (CAS 115621-95-9) is a chemical compound with the molecular formula C22H25Cl2N3 and a molecular weight of 402.4 g/mol. IUPAC name: 5-(4-piperidin-1-ylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline;dihydrochloride. InChIKey: BKOQATFPPHQOQH-UHFFFAOYSA-N.
| Molecular formula | C22H25Cl2N3 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 5-(4-piperidin-1-ylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline;dihydrochloride |
| InChIKey | BKOQATFPPHQOQH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)C3=CC4=CC=CC=C4C5=NCCN35.Cl.Cl |
Computed by PubChem (NCBI)