CAS 1609522-33-9 appears in our catalog under these names: SEL120-34A/ 99.7% (existing batch purity), SEL120–34A, CDK8-IN-2, SEL120-34A, 99.76% ,, 99.76% ,, Romaciclib, 99.49%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 25 mg.
6,7-dibromo-5-methyl-2-piperazin-1-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (CAS 1609522-33-9) is a chemical compound with the molecular formula C15H18Br2N4 and a molecular weight of 414.14 g/mol. IUPAC name: 6,7-dibromo-5-methyl-2-piperazin-1-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene. InChIKey: FSBMCTDYWXIBLM-UHFFFAOYSA-N.
| Molecular formula | C15H18Br2N4 |
|---|---|
| Molecular weight | 414.14 g/mol |
| IUPAC name | 6,7-dibromo-5-methyl-2-piperazin-1-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| InChIKey | FSBMCTDYWXIBLM-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(CCCN3C(=N2)N4CCNCC4)C(=C1Br)Br |
Computed by PubChem (NCBI)