CAS 2139330-34-8 appears in our catalog under these names: SERCA2a activator 1, 98%, SERCA2a activator 1/ 99.52% (existing batch purity), SERCA2a activator 1, SERCA2a activator 1, SERCA2a activator 1, 99.71%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100 mg, 10 mg.
2-(5-benzyl-1-butyl-6-oxo-3-pyridinyl)-N-naphthalen-2-ylsulfonylpyridine-4-carboxamide (CAS 2139330-34-8) is a chemical compound with the molecular formula C32H29N3O4S and a molecular weight of 551.7 g/mol. IUPAC name: 2-(5-benzyl-1-butyl-6-oxo-3-pyridinyl)-N-naphthalen-2-ylsulfonylpyridine-4-carboxamide. InChIKey: DBGJRQXKIIMWLS-UHFFFAOYSA-N.
| Molecular formula | C32H29N3O4S |
|---|---|
| Molecular weight | 551.7 g/mol |
| IUPAC name | 2-(5-benzyl-1-butyl-6-oxo-3-pyridinyl)-N-naphthalen-2-ylsulfonylpyridine-4-carboxamide |
| InChIKey | DBGJRQXKIIMWLS-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C(C=C(C1=O)CC2=CC=CC=C2)C3=NC=CC(=C3)C(=O)NS(=O)(=O)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)