CAS 107729-45-3 appears in our catalog under these names: (1,5-Dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid, SF2312/ 99.98% (existing batch purity), SF2312, SF2312 98+%, SF2312, 95.0%. Offered by: Chemat, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(1,5-dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid (CAS 107729-45-3) is a chemical compound with the molecular formula C4H8NO6P and a molecular weight of 197.08 g/mol. IUPAC name: (1,5-dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid. InChIKey: CGWBGDOPBYWJKZ-UHFFFAOYSA-N.
| Molecular formula | C4H8NO6P |
|---|---|
| Molecular weight | 197.08 g/mol |
| IUPAC name | (1,5-dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid |
| InChIKey | CGWBGDOPBYWJKZ-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1O)O)P(=O)(O)O |
Computed by PubChem (NCBI)