cas: 1997319-84-2 — see every product listed under this CAS number, including other names
SGC-SMARCA-BRDVIII 99% (CAS 1997319-84-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1602887-1mg |
| cas | 1997319-84-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 298.06 Pln | |
| Ambeed | 5mg | 359.25 Pln | |
| Ambeed | 10mg | 437.12 Pln | |
| Ambeed | 25mg | 542.81 Pln | |
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1099.06 Pln | |
| Ambeed | 250mg | 2022.44 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1602887 |
Tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate (CAS 1997319-84-2) is a chemical compound with the molecular formula C19H25N5O3 and a molecular weight of 371.4 g/mol. IUPAC name: tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate. InChIKey: AQTNUGRRZDRZIA-UHFFFAOYSA-N.
| Molecular formula | C19H25N5O3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate |
| InChIKey | AQTNUGRRZDRZIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=NN=C2N)C3=CC=CC=C3O |
Computed by PubChem (NCBI)