CAS 1997319-84-2 appears in our catalog under these names: SGC-SMARCA-BRDVIII/ 99.6% (existing batch purity), SGC–SMARCA–BRDVIII, SGC-SMARCA-BRDVIII 99%, SGC-SMARCA-BRDVIII, 99.66%, tert-Butyl 4-(3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl)piperazine-1-carboxylate, 99%, 99%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
Tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate (CAS 1997319-84-2) is a chemical compound with the molecular formula C19H25N5O3 and a molecular weight of 371.4 g/mol. IUPAC name: tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate. InChIKey: AQTNUGRRZDRZIA-UHFFFAOYSA-N.
| Molecular formula | C19H25N5O3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | tert-butyl 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazine-1-carboxylate |
| InChIKey | AQTNUGRRZDRZIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=NN=C2N)C3=CC=CC=C3O |
Computed by PubChem (NCBI)